1. The Parametrisation of the Friedmann Equation

It is well known, that the Radius of Curvature in the Field Equations of General Relativity relates to the Energy-Mass Tensor in the form of the critical density ρcritical = 3Ho2/8πG and the Hubble Constant Ho as the square of frequency or alternatively as the time differential of frequency df/dt as a cosmically applicable angular acceleration independent on the radial displacement.

The scientific nomenclature (language) then describes this curved space in differential equations relating the positions of the 'points' in both space and time in a 4-dimensional description called Riemann Tensor Space or similar.

This then leads mathematically, to the formulation of General Relativity in Einstein's field Equations:

einstein1.

for the Einstein-Riemann tensor

einstein2.


and is built upon ten so-called nonlinear coupled hyperbolic-elliptic partial differential equations, which needless to say, are mathematically rather complex and often cannot be solved analytically without simplifying the geometries of the parametric constituents (say objects interacting in so called tensor-fields of stress-energy {Tμν} and curvatures in the Riemann-Einstein tensor {Gμν}, either changing the volume in reduction of the Ricci tensor {Rij} with scalar curvature R as {Rgμν} for the metric tensor {gμν} or keeping the volume of considered space invariant to volume change in a Tidal Weyl tensor {Rμν}).

The Einstein-Riemann tensor then relates Curvature Radius R to the Energy-Mass tensor E=Mc2 via the critical density as 8πG/c4=3Ho2Vcritical.Mcritical.c2/Mcritical.c4 = 3Ho2Vcritical/c2 = 3Vcritical/R2 as Curvature Radius R by the Hubble Law applicable say to a nodal Hubble Constant Ho = c/RHubble.

The cosmological field equations then can be expressed as the square of the nodal Hubble Constant and inclusive of a 'dark energy' terms often identified with the Cosmological Constant of Albert Einstein, here denoted ΛEinstein.
Substituting the Einstein Lambda with the time differential for the square of nodal Hubble frequency as the angular acceleration acting on a quantized volume of space however; naturally and universally replaces the enigma of the 'dark energy' with a space inherent angular acceleration component, which can be identified as the 'universal consciousness quantum' directly from the standard cosmology itself.

The field equations so can be generalised in a parametrization of the Hubble Constant assuming a cyclic form, oscillating between a minimum and maximum value given by Ho=dn/dt for cycle time n=Hot and where then time t is the 4-vector time-space of Minkowski light-path x=ct.

The Einstein Lambda then becomes then the energy-acceleration difference between the baryonic mass content of the universe and an inherent mass energy related to the initial condition of the oscillation parameters for the nodal Hubble Constant.

ΛEinstein = GoMo/R(n)2 - 2cHo/(n+1)3 = Cosmological Acceleration - Intrinsic Universal Milgröm Deceleration as: gμνΛ = 8πG/c4 Tμν - Gμν

then becomes Gμν + gμνΛ = 8πG/c4 Tμν and restated in a mass independent form for an encompassment of the curvature fine structures.


Energy Conservation and Continuity:

dE + PdV = TdS =0 (First Law of Thermodynamics) for a cosmic fluid and scaled Radius R=a.Ro; dR/dt = da/dt.Ro and d2R/dt2 = d2a/dt2.Ro

dV/dt = {dV/dR}.{dR/dt} = 4πa2Ro3.{da/dt}

dE/dt = d(mc2)/dt = c2.d{ρV}/dt = (4πRo3.c2/3){a3.dρ/dt + 3a2ρ.da/dt}

dE + PdV = (4πRo3.a2){ρc2.da/dt + [ac2/3].dρ/dt + P.da/dt} = 0 for the cosmic fluid energy-pressure continuity equation:

dρ/dt = -3{(da/dt)/a.{ρ + P/c2}} .........................................................................................(1)


The independent Einstein Field Equations of the Robertson-Walker metric reduce to the Friedmann equations:

H2 = {(da/dt)/a}2 = 8πGρ/3 - kc2/a2 + Λ/3 ...................................................................................(2)

{(d2a/dt2)/a} = -4πG/3{ρ+ 3P/c2} + Λ/3 ..................................................................................(3)

for scale radius a=R/Ro; Hubble parameter H = {da/dt)/a}; Gravitational Constant G; Density ρ; Curvature k ; light speed c and Cosmological Constant Λ.

Differentiating (2) and substituting (1) with (2) gives (3):

{2(da/dt).(d2a/dt2).a2 - 2a.(da/dt).(da/dt)2}/a4 = 8πG.(dρ/dt)/3 + 2kc2.(da/dt)/a3 + 0 = (8πG/3)(-3{(da/dt)/a.{ρ + P/c2}} + 2kc2.(da/dt)/a3 + 0

(2(da/dt)/a).{(d2a/dt2).a - (da/dt)2}/a2 = (8πG/3){-3(da/dt)/a}.{ρ + P/c2} + 2{(da/dt)/a}.(kc2/a2) +0


2{(da/dt)/a}.{(d2a/dt2).a - (da/dt)2}/a2 = 2{(da/dt)/a}{-4πG.{ρ + P/c2} + (kc2/a2)} +0 with kc2/a2= 8πGρ/3 + Λ/3 - {(da/dt)/a}2

d{H2}/dt = 2H.dH/dt = 2{(da/dt)/a}.dH/dt

dH/dt = {[d2a/dt2]/a - H2} = {-4πG.(ρ+ P/c2) + 8πGρ/3 + Λ/3 -H2} = -4πG/3(ρ + 3P/c2) + Λ/3 - H2} = -4πG/3(ρ + 3P/c2) + Λ/3 - 8πGρ/3 + kc2/a2 - Λ/3} = -4πG.(ρ + P/c2) + kc2/a2

dH/dt = -4πG{ρ+P/c2} as the Time derivative for the Hubble parameter H for flat Minkowski space-time with curvature k=0

{(d2a/dt2).a - (da/dt)2}/a2 = -4πG{ρ+ P/c2} + (kc2/a2) + 0 = -4πG{ρ + P/c2} + 8πGρ/3 - {(da/dt)/a}2 + Λ/3

{(d2a/dt2)/a} = (-4πG/3){3ρ + 3P/c2- 2ρ} = (-4πG/3){ρ + 3P/c2} + Λ/3 = dH/dt + H2

For a scale factor a=n/[n+1] = {1-1/[n+1]} = 1/{1+1/n}​

 

dH/dt + 4πGρ = - 4πGP/c2 .... (for V4/10D=[4π/3]RH3 and V5/11D=2π2RH3 in factor 3π/2)

areset = Rk(n)AdS/Rk(n)dS + ½ = n-∑∏nk-1+∏nk

Scale factor modulation at Nk={[n-∑∏nk-1]/Πnk } = ½ reset coordinate

{dH/dt} = areset .d{Ho/T(n)}/dt = - Ho2(2n+1)(n+3/2)/T(n)2 for k=0

dH/dt + 4πGρ = - 4πGP/c2

-Ho2(2n+1)(n+3/2)/T(n)2 + GoMo/{RH3(n/[n+1])3}{4π} = Λ(n)/{RH(n/[n+1])} + Λ/3 - 2Ho2{[n+1]2-¼}/T[n]2 + GoMo/RH3(n/[n+1])3{4π} = Λ(n)/RH(n/[n+1]) + Λ/3 - 2Ho2{[n+1]2-¼}/T(n)2 + 4π.GoMo/RH3(n/[n+1])3 = Λ(n)/RH(n/[n+1]) + Λ/3

For a scale factor a=n/[n+1] = {1-1/[n+1]} = 1/{1+1/n}

Λ(n)/RH(n/[n+1]) = - 4πGP/c2 = GoMo/RH3(n/[n+1])3- 2Ho2/(n[n+1]2)

and Λ = 0

for -P(n) = Λ(n)c2[n+1]/4πGonRH = Λ(n)Hoc[n+1]/4πGon = Moc2[n+1]3/4πn3RH3 - Ho2c2/2πGon[n+1]2


For n=1.13271:............ - (+6.696373x10-11 J/m3)* = (2.126056x10-11 J/m3)* + (-8.8224295x10-11 J/m3)*
Negative Dark Energy Pressure = Positive Matter Energy + Negative Inherent Milgröm Deceleration (cHo/Go)​



The Dark Energy and the 'Cosmological Constant' exhibiting the nature of an intrinsic negative pressure in the cosmology become defined in the overall critical deceleration and density parameters. The pressure term in the Friedmann equations being a quintessence of function n and changing sign from positive to negative to positive as indicated.

For a present measured deceleration parameter qdS=-0.5586, the DE Lambda calculates as -6.696x10-11 (N/m2=J/m3)*, albeit as a positive pressure within the negative quintessence.


2. An expanding multi-dimensional super-membraned open and closed Universe


The expansion of the universe can be revisited in a reformulation of the standard cosmology model Lambda-Cold-Dark-Matter or LCDM in terms of a parametrization of the standard expansion parameters derived from the Friedmann equation, itself a solution for the Einstein Field Equations (EFE) applied to the universe itself.
A measured and observed flat universe in de Sitter (dS) 4D-spacetime with curvature k=0, emerges as the result of a topological mirror symmetry between two Calabi Yau manifolds encompassing the de Sitter space time in a multi timed connector dimension.
The resulting multiverse or brane world so defines a singular universe with varying but interdependent time cyclicities.

It is proposed, that the multiverse initiates cyclic periods of hyper acceleration or inflation to correlate and reset particular initial and boundary conditions related to a baryonic mass seedling proportional to a closure or Hubble mass to ensure an overall flatness of zero curvature for every such universe parallel in a membrane time space but co-local in its lower dimensional Minkowski space-time.

On completion of a 'matter evolved' Hubble cycle, defined in characteristic Hubble parameters; the older or first universal configuration quantum tunnels from its asymptotic Hubble Event horizon into its new inflaton defined universal configuration bounded by a new Hubble node.
The multidimensional dynamics of this quantum tunneling derives from the mirror symmetry and topological duality of the 11-dimensional membrane space connecting two Calabi Yau manifolds as the respective Hubble nodes for the first and the second universal configurations.


Parallel universes synchronise in a quantized protoverse as a function of the original lightpath of the Instanton, following not preceding a common boundary condition, defined as the Inflaton.
The initial conditions of the Inflaton so change as a function of the imposed cyclicity by the boundary conditions of the paired Calabi Yau mirror duality; where the end of a Instanton cycle assumes the new initial conditions for the next cycle of the Instanton in a sequence of Quantum Big Bangs.

The outer boundary of the second Calabi Yau manifold forms an open dS space-time in 12-dimensional brane space (F-Vafa 'bulk' Omnispace) with negative curvature k=-1 and cancels with its inner boundary as a positively curved k=1 spheroidal AdS space-time in 11 dimensions to form the observed 4D/10-dimensional zero curvature dS space-time, encompassed by the first Calabi Yau manifold.

A bounded (sub) 4D/10D dS space-time then is embedded in a Anti de Sitter (AdS) 11D-space-time of curvature k=+1 and where 4D dS space-time is compactified by a 6D Calabi Yau manifold as a 3-torus and parametrized as a 3-sphere or Riemann hypersphere.
The outer boundary of the 6D Calabi Yau manifold then forms a mirror duality with the inner boundary of the 11D Calabi Yau event horizon.

Every Inflaton defines three Hubble nodes or timespace mirrors; the first being the 'singularity - wormhole' configuration; the second the nodal boundary for the 4D/10D dS space-time and the third the dynamic lightpath bound for the Hubble Event horizon in 5D/11D AdS time-space.
The completion of a 'de Broglie wave matter' evolution cycle triggers the Hubble Event Horizon as the inner boundary of the time-space mirrored Calabi Yau manifold to quantum tunnel onto the outer boundary of the space-time mirrored Calabi Yau manifold in a second universe; whose inflaton was initiated when the light-path in the first universe reached its second Hubble node.

For the first universe, the three nodes are set in time-space as {3.3x10-31 s; 16.88 Gy; 3.96 Ty} and the second universe, time shifted in t1=to+t with to=1/Ho has a nodal configuration {to+1.4x10-33; to+3,957 Gy; to+972.7 Ty}; the latter emerging from the time-space as the instanton at time marker to.
A third universe would initiate at a time coordinate t2=to+t1+t as {1/Ho+234.472/Ho +5.8x10-36 s; to+t1+972.7 Ty; to+t1+250,223 Ty}; but as the second node in the second universe cannot be activated by the lightpath until the first universe has reached its 3.96 trillion year marker (and at a time for a supposed 'heat death' of the first universe due to exhaustion of the nuclear matter sources); the third and following nested universes cannot be activated until the first universe reaches its n=1+234.472=235.472 time-space coordinate at 3,974.8 billion years from the time instanton aka the Quantum Big Bang.

For a present time-space coordinate of npresent=1.13271 however; all information in the first universe is being mirrored by the time-space of the AdS space-time into the dS space-time of the second universe at a time frame of t = t1-to = 19.12 - 16.88 = 2.24 billion years and a multi-dimensional time interval characterizing the apparent acceleration observed and measured in the first universe of the Calabi Yau manifold compressed or compactified flat dS Minkowski cosmology. The solution to the Dark Energy and Dark Matter question of a 'missing mass' cosmology is described in this discourse and rests on the evolution of a multiverse in matter.

Yn = RHubble/rWeyl = 2πRHubbleWeyl = ωWeyl/Ho = 2πnWeyl = nps/2π = 1.003849x1049

2nd Inflaton/Quantum Big Bang redefines for k=1: RHubble(1) = n1RHubble = c/Ho(1) = (234.472)RHubble = 3.746x1028 m* in 3.957 Trillion Years for critical nk

3rd Inflaton/Quantum Big Bang redefines for k=2: RHubble(2) = n1n2RHubble = c/Ho(2) = (234.472)(245.813)RHubble = 9.208x1030 m* in 972.63 Trillion Years for critical nk

4th Inflaton/Quantum Big Bang redefines for k=3: RHubble(3) = n1n2n3RHubble = c/Ho(3) = (57,636.27)(257.252)RHubble = 2.369x1033 m* in 250.24 Quadrillion Years for critical nk

5th Inflaton/Quantum Big Bang redefines for k=4: RHubble(4) = n1n2n3n4RHubble = c/Ho(4) = (14,827,044.63)(268.785)RHubble = 6.367x1035 m* in 67.26 Quintillion Years for critical nk

...

(k+1)th Inflaton/Quantum Big Bang redefines for k=k: RHubble(k) = RHubble Π nk = c/Ho Π nk

.....

nk = ln{ωWeylRHubble(k)/c}/lnY = ln{ωWeyl/Ho(k)}/lnY

n1 = 234.471606...

n2 = 245.812422...

n3 = 257.251394...

n4 = 268.784888...

Dark Energy DE-Quintessence  Λk Parameters:

A general dark energy equation for the kth universe (k=0,1,2,3,...) in terms of the parametrized Milgröm acceleration A(n); comoving recession speed V(n) and scale factored curvature radius R(n):

Λk (n) = GoMo/Rk(n)2 - 2cHo(Πnk)2/{n-ΣΠnk-1+Πnk)3}     for negative Pressure  Pk  = -Λk(n)c2/4πGoRk

= {GoMo(n-ΣΠnk-1+Πnk)2/{(Πnk)2.RH2(n-ΣΠnk-1)2} - 2cHo(Πnk)2/{n-ΣΠnk-1+Πnk)3}

Λo = GoMo(n+1)2/RH2(n)2 - 2cHo/(n+1)3

Λ1 = GoMo(n-1+n1)2/n12RH2(n-1)2 - 2cHon12/(n-1+n1)3

Λ2 = GoMo(n-1-n1+n1n2)2/n12n22RH2(n-1-n1)2 - 2cHon12n22/(n-1-n1+n1n2)3

.....

Lambda-DE-Quintessence Derivatives:

Λk'(n) = d{Λk}/dn =

{GoMo/Πnk2RH2}{2(n-ΣΠnk-1+Πnk).(n-ΣΠnk-1)2 - 2(n-ΣΠnk-1).(n-ΣΠnk-1+Πnk)2}/{(n-ΣΠnk-1)4} - {-6cHo(Πnk)2}/(n-ΣΠnk-1+Πnk)4

= {-2GoMo/ΠnkRH2}(n-ΣΠnk-1+Πnk)/(n-ΣΠnk-1)3 + {6cHo(Πnk)2}/(n-ΣΠnk-1+Πnk)4

= {6cHo(1)2}/{(n-0+1)4} - {2GoMo/1.RH2}{(n-0+1)/(n-0)3}........................................ for k=0

= {6cHo(1.n1)2}/{(n-1+n1)4} - {2GoMo/n1.RH2}{(n-1+n1)/(n-1)3}................................ for k=1

= {6cHo(1.n1.n2)2}/{(n-1-n1+n1.n2)4} - {2GoMo/n1n2.RH2}{(n-1-n1+n1n2)/(n-1-n1)3}...... for k=2

.......

For k=0;   {GoMo/3c2RH} = constant = n3/[n+1]5

for roots nΛmin = 0.23890175.. and nΛmax = 11.97186...

{GoMo/2c2RH} = constant =  [n]2/[n+1]5

for Λo-DE roots: n+/- = 0.1082331...  and   n-/+ = 3.40055...   for asymptote Λ0∞ = GoMo/RH2 = 7.894940128...x10-12 (m/s2)*

For k=1; {GoMo/3n13c2RH} = constant = [n-1]3/[n-1+n1]5  = [n-1]3/[n+233.472]5

for roots nΛmin = 7.66028... and nΛmax = 51,941.9..

{GoMo/2n14c2RH} = constant = [n-1]2/[n-1+n1]5 = [n-1]2/[n+233.472]5

for Λ1-DE roots: n+/- = 2.29966...  and   n-/+ = 7,161.518...   for asymptote Λ1∞ = GoMo/n12RH2 = 1.43604108...x10-16 (m/s2)*

For k=2; {GoMo/3n13n23c2RH} = constant = [n-1-n1]3/[n-1-n1+n1n2]5 = [n-235.472]3/[n+57,400.794]5

for roots nΛmin = 486.7205  and nΛmax = 2.0230105x108

{GoMo/2n14n24c2RH} = constant = [n-1-n1]2/[n-1-n1+n1n2]5 = [n-235.472]2/[n+57,400.794]5

for Λ2-DE roots: n+/- = 255.5865...  and   n-/+ = 1.15382943...x107   for asymptote Λ2∞ = GoMo/n12n22RH2 = 2.37660590...x10-21 (m/s2)*

For k=3; {GoMo/3n13n23n33c2RH} = constant = [n-1-n1-n1n2]3/[n-1-n1-n1n2+n1n2n3]5 = [n-57,871.74]3/[n+1.47691729x107]5

for roots nΛmin = 67,972.496  and nΛmax = 8.3526797...x1011

{GoMo/2n14n24n34c2RH} = constant = [n-1-n1-n1n2]2/[n-1-n1-n1n2+n1n2n3]5 = [n-57,871.74]2/[n+1.47691729x107]5

for Λ3-DE roots: n+/- = 58,194.1...  and   n-/+ = 1.9010262...x1010  for asymptote Λ3∞ = GoMo/n12n22n32RH2 = 3.59120049...x10-26 (m/s2)*

and where

Πnk=1=no and Πnk-1=0 for k=0

with Instanton/Inflaton resetting for initial boundary parameters

Λo/adeBroglie = {GoMo/Rk(n)2}/ΠnkRHfps2

= {GoMo(n-ΣΠnk-1+Πnk)2}/{[Πnk]2.RH2(n-ΣΠnk-1)2(ΠnkRHfps2)} = (Πnk)½Ωo

for Instanton-Inflaton Baryon Seed Constant Ωo = Mo*/MH* = 0.02803 for the kth universal matter evolution

k=0 for Reset n=nps=Hot and Λo/adeBroglie = GoMo(nps+1)2/{RH3nps2(fps2)} = GoMo/RHc2 = Mo/2MH = ½Ωo

k=1 for Reset n=1+nps and Λo/adeBroglie = GoMo(1+nps-1+n1)2/{[n1]2.RH3(1+nps-1)2(n1fps2)} = Mo/2n1MH = Mo/2MH* = ½Ωo*

k=2 for Reset n=n1+1+nps and Λo/adeBroglie = GoMo(n1+1+nps-1-n1+n1n2)2/{[n1n2]2.RH3(n1+1+nps-1-n1)2(n1n2fps2)} = ½Ωo**

k=3 for Reset n=n1n2+n1+1+nps and Λo/adeBroglie = GoMo(n1n2+n1+1+nps-1-n1-n1n2+n1n2n3)2/{[n1n2n3]2.RH3(n1n2+n1+1+nps-1-n1-n1n2)2(n1n2n3fps2)} = ½Ωo***

......

with nps = 2πΠnk-1.Xnkps/RH = Hotps = Ho/fps = ctps/RH and RH=2GoMH/c2

No=Hoto/no=Hot=n

N1=Hot1/n1=(n-1)/n1

N2=Hot2/n1n2=(n-1-n1)/n1n2

N3=Hot3/n1n2n3=(n-1-n1-n1n2)/n1n2n3

....

dn/dt=Ho

.....

Nk=Hotk/Πnk=(n-ΣΠnk-1)/Πnk

tk = t - (1/Ho)ΣΠnk-1 for no=1 and No=n

to=t=n/Ho=No/Ho=nRH/c

t1=t-1/Ho=(n-1)/Ho=[n1N1]/Ho

t2=t-(1+n1)/Ho=(n-1-n1)/Ho=(n1n2N2)/Ho

t3=t-(1+n1+n1n2)/Ho=(n-1-n1-n1n2)/Ho=(n1n2n3N3)/Ho

.......

R(n)=R(No)=noRH{n/[n+1]}=RH{n/[n+1]}

R1(N1)=n1RH{N1/[N1+1]}=n1RH{[n-1]/[n-1+n1]}

R2(N2)=n1n2RH{N2/[N2+1]}=n1n2RH{[n-1-n1]/[n-1-n1+n1n2]}

R3(N3)=n1n2n3RH{N3/[N3+1]}=n1n2n3RH{[n-1-n1-n1n2]/[n-1-n1-n1n2+n1n2n3}

.......

Rk(n) = ΠnkRH(n-ΣΠnk-1)/{n-ΣΠnk-1+Πnk}

.....= RH(n/[n+1]) = n1RH(N1/[N1+1]) = n1n2RH(N2/[N2+1]) =.....

Vk(n) = dRk(n)/dt = c{Πnk}2/{n-ΣΠnk-1+Πnk}2

.....= c/[n+1]2 = c/[N1+1]2 = c/[N2+1]2 =.....

.....= c/[n+1]2 = c(n1)2/[n-1+n1]2 = c(n1n2)2/[n-1-n1+n12n22]2 =.....

Ak(n) = d2Rk(n)/dt2 = -2cHo(Πnk)2/(n-ΣΠnk-1+Πnk)3

.....= -2cHo/(n+1)3 = -2cHo/n1(N1+1)3 = -2cHo/n1n2(N2+1)3=.....

..... = -2cHo/[n+1]3 = -2cHo{n1}2/[n-1+n1]3 = -2cHo(n1n2)2/[n-1-n1+n1n2]3 =.....

GoMo is the Gravitational Parameter for the Baryon mass seed; Curvature Radius RH = c/Ho in the nodal Hubble parameter Ho and c is the speed of light

Hubble Parameters:

H(n)|dS = {Vk(n)}/{Rk(n)} = {c[Πnk]2/[n-ΣΠnk-1+Πnk]2}/{Πnk.RH[n-ΣΠnk-1]/(n-ΣPnk-1+Πnk)} = ΠnkHo/{[n-ΣΠnk-1][n-ΣΠnk-1+Πnk]}

H(n)|dS = ΠnkHo/{[n-ΣΠnk-1][n-ΣΠnk-1+Πnk]}

.....= Ho/{[n][n+1]}=Ho/T(n) = n1Ho/{[n-1][n-1+n1]} = n1n2Ho/{[n-1-n1][n-1-n1+n1n2]} =..... for dS

H(n)'|dS = Ho/[n-ΣΠnk-1] for oscillating H'(n) parameter between nodes k and k+1 ||nps+ΣΠnk-1 - ΣΠnk||

H(n)|AdS = H(n)'|AdS = {Vk(n)}/{Rk(n)} = c/{RH(n-ΣΠnk-1)}

H(n)|AdS = H(n)' = Ho/(n-ΣΠnk-1)

.....= Ho/n = Ho/(n-1) = Ho/(n-1-n1) =..... for AdS

For initializing scale modulation Rk(n)Ads/Rk(n)dS + ½ = ΠnkRH(n-ΣΠnk-1)/{ΠnkRH(n-ΣΠnk-1)/(n-ΣΠnk-1+Πnk)} + ½Πnk  = {n - ΣΠnk-1 + Πnk + ½} reset coordinate

dH/dt = (dH/dn)(dn/dt) = -Πnk.Ho2{(2n-2ΣΠnk-1+Πnk)(n-ΣΠnk-1+Πnk+½Πnk)}/{n2-2nΣΠnk-1+(ΣΠnk-1)2+Πnk[n-ΣΠnk]}2

= -2ΠnkHo2{[n - ΣΠnk-1 + Πnk]2 - ¼ΣΠnk2}/{(n-ΣΠnk-1)(n-ΣΠnk-1+Πnk)}2

dH/dt|dS = -2ΠnkHo2{[n - ΣΠnk-1 + Πnk]2 - ¼(ΣΠnk)2}/{(n-ΣΠnk-1)(n-ΣΠnk-1+Πnk)}2

.....= -2Ho2([n+1]2-¼)/{n[n+1]}2 = -2n1Ho2{[n-1+n1]2-¼n12}/{[n-1][n-1+n1]}2 = -2n1n2Ho2{[n-1-n1+n1n2]2-¼n12n22}/{[n-1-n1][n-1-n1+n1n2]}2 =.....

dH/dt = (dH/dn)(dn/dt) = -Hoc/{(RH(n-ΣΠnk-1)2} = -Ho2/{n-ΣΠnk-1}2 for AdS

dH/dt|AdS  = -Ho2/{n-ΣΠnk-1}2

.....= -Ho2/n2 = Ho2/(n-1)2  = -Ho2/(n-1-n1)2 = .....

dH/dt  + 4πGoρ = - 4πGoP/c2

dH/dt + 4πGoMo/Rk(n)3 = Λk(n)/Rk(n) = - 4πGoP/c2  =  GoMo/Rk(n)3 - 2(Πnk)Ho2/{(n-ΣΠnk-1)(n-ΣΠnk-1+Πnk)2} for dS with

{-4π}P(n)|dS = Moc2/Rk(n)3 - 2Πnk(Hoc)2/{Go(n-ΣΠnk-1)(n-ΣΠnk-1+Πnk)2} = Moc2(n-ΣΠnk-1+Πnk)3/{Πnk.RH(n-ΣΠnk-1)}3 - 2ΠnkHo2c2/{Go(n-ΣΠnk-1)(n-ΣΠnk-1+Πnk)2}

Λk(n)/Rk(n) = -4πGoP/c2  =  GoMo/Rk(n)3 - dH/dt = GoMo/{RH(n-ΣΠnk-1)}3 - Ho2/{n-ΣΠnk-1}2  for  AdS with

{-4π}P(n)|AdS = Moc2/Rk(n)3 - (Hoc)2/{Go(n-ΣΠnk-1)2} = Moc2/{RH(n-ΣΠnk-1)}3 - Ho2c2/{Go(n-ΣΠnk-1)2}

Deceleration Parameters:

qAdS(n) = -Ak(n)Rk(n)/Vk(n)2 = -{(-2cHo[Πnk]2)/(n-ΣΠnk-1+Πnk)3}{ΠnkRH(n-ΣΠnk-1)/(n-ΣΠnk-1+Πnk)}/{[Πnk]2c/(n-ΣΠnk-1+Πnk)}2 = 2(n-ΣΠnk-1)/Πnk

qAdS+dS(n) = 2(n-ΣΠnk-1)/Πnk

qdS(n) = 1/qAdS+dS(n) - 1 = Πnk/{2[n-ΣΠnk-1} - 1

with Ak(n)=0 for AdS  in areset = Rk(n)AdS/Rk(n)dS + ½ = {RH(n-ΣΠnk-1)}/{RH(n-ΣΠnk-1)/(n-ΣΠnk-1+1)} + ½ = n-ΣΠnk-1+1+½

Scalefactor modulation at Nk = {n-ΣΠnk-1}/Πnk = ½ reset coordinate

.....= 2n = 2(n-1)/n1 = 2(n-1-n1)/(n1n2) = 2(n-1-n1-n1n2)/(n1n2n3) = ..... for AdS

.....= 1/{2n} -1 = n1/{2[n-1]} -1 = n1n2/{2(n-1-n1)} -1 =  n1n2n3/{2(n-1-n1-n1n2)} -1   = ..... for dS

Dark Energy Initiation for qdS=1 with qAdS=1

k=0  for n = ½ = 0.50000 for qdS=0 with qAdS=1

k=1 for n = ½n1+1 = 118.236..  for  qdS=0 with qAdS=1

k=2 for n = ½n1n2+n1+1 = 29,053.605..  qdS=0 with qAdS=1

k=3 for n = ½n1n2n3+n1n2+n1+1 = 7,471,394.054.. qdS=0 with qAdS=1

Temperature:

T(n) ={Moc2/(1100σπ2.Rk(n)2.tk)} and for tk = (n-ΣΠnk-1)/Ho

Tk(n) ={HoMoc2(n-ΣΠnk-1+Πnk)2/[1100σπ2.RH2.(n-ΣΠnk-1)3]}

={(Ho3Mo(n-ΣΠnk-1+Πnk)2)/[1100σπ2(n-ΣΠnk-1)3]} = {18.199(n-ΣΠnk-1+Πnk)2/(n-ΣΠnk-1)3}

T(n) .....= {18.2[n+1]2/n3} ={18.2[n-1+n1]2/(n-1)3} = {18.2[n-1-n1+n1n2]2/(n-1-n1)3} =.....

Comoving Redshift:

z + 1 = √{(1+v/c)/(1-v/c)} = √{([n-ΣΠnk-1+Πnk]2+[Πnk]2)/([n-ΣΠnk-1+Πnk]2-[Πnk]2)} =

√{([n-ΣΠnk-1]2+2Πnk(n-ΣΠnk-1)+2(Πnk)2)/([n-ΣΠnk-1]2+2Πnk(n-ΣΠnk-1)} = √{1 + 2(Πnk)2/{(n-ΣΠnk-1)(n-ΣΠnk-1+2Πnk)}

z+1 = √{ 1 + 2/{[n2-2nΣΠnk-1 +(ΣΠnk-1)2+2n-2ΣΠnk-1} = √{1+2/{n(n+2-2ΣΠnk-1) + ΣΠnk-1(ΣΠnk-1-2)}}

....= √{1+2/(n[n+2])} = √{1+2/([n-1][n-1+2n1])} = √{1+2/([n-1-n1][n-1-n1+2n1n2])} =......

Baryon-Dark Matter Saturation:

ΩDM = 1-ΩBM until Saturation for  BM-DM and Dark Energy  Separation

ρBM+DM/ρcritical = ΩoY{[n-ΣΠnk-1]/Πnk}/{(n-ΣΠnk-1)/(n-ΣΠnk-1+Πnk)}3 = MoY{[n-ΣΠnk-1]/Πnk}/{ρcriticalRk(n)3}

Baryon Matter Fraction  ΩBM = ΩoY{Nk} = Ωo.Y{[n-ΣΠnk-1]/Πnk}

Dark Matter Fraction  ΩDM = ΩoY{[n-ΣΠnk-1]/Πnk}{1-{(n-ΣΠnk-1)/(n-ΣΠnk-1+Πnk)}3/{(n-ΣΠnk-1)/(n-ΣΠnk-1+Πnk)}3 = ΩoY{[n-ΣΠnk-1]/Πnk}{(n-ΣΠnk-1+Πnk)3-(n-ΣΠnk-1)3}/{n-ΣΠnk-1}3

= ΩoY{[n-ΣΠnk-1]/Πnk}{(1+Πnk/[n-ΣΠnk-1])3 -1} = ΩBM{(1+Πnk/[n-ΣΠnk-1])3 -1}

Dark Energy Fraction  ΩDE = 1- ΩDM - ΩBM = 1 - ΩBM{(1+Πnk/[n-ΣΠnk-1])3}

ΩBM=constant=0.0553575 from Saturation to Intersection with Dark Energy Fraction

ΩoY{[n-ΣΠnk-1]/Πnk} = ρBM+DMRk(n)3/MH = [Nk]3/[Nk+1]3 = {(n-ΣΠnk-1)/(n-ΣΠnk-1+Πnk)}3 = Rk(n)3/VH = VdS/VAdS

for ρBM+DM = MH/RH3 = ρcritical and for Saturation at Ni = 6.541188... = constant ∀ Ni

(Mo/MH).Y{[n-ΣΠnk-1]/Πnk} =  {(n-ΣΠnk-1)/(n-ΣΠnk-1+Πnk)}3  with a Solution for f(n) in Newton-Raphson Root Iteration and first Approximation x0

xk+1 = xk - f(n)/f'(n) = xk -  {(Mo/MH).Y{[n-∑∏nk-1]/Πnk} - (n-∑∏nk-1)/(n-ΣΠnk-1+Πnk)3}/{(Mo/MH).[lnY]Y{[n-ΣΠnk-1]/Πnk} - 3(n-ΣΠnk-1)2/(n-ΣΠnk-1+Πnk)4}

x1 = x0 - {(Mo/MH).Y[n] - (n/n+1)3}/{(Mo/MH).[lnY]Y[n] - 3n2/[n+1]4}

= x0 - {(Mo/MH).Y{N0} - (N0)3/(N0+1)3}/{(Mo/MH).[lnY]Y{N0} - 3(N0)2/1(N0+1)4}

x1 = x0 - {(Mo/MH).Y{[n-1]/n1} - (n-1)3/(n-1+n1)3}/{(Mo/MH).[lnY]Y{[n-1]/n1} - 3(n-1)2/(n-1+n1)4}

= x0 - {(Mo/MH).Y{N1} - (N1)3/(N1+1)3}/{(Mo/MH).[lnY]Y{N1} - 3(N1)2/n1(N1+1)4}

x1 = x0 - {(Mo/MH).Y{[n-1-n1]/n1n2} - (n-1-n1)3/(n-1-n1+n1n2)3}/{(Mo/MH).[lnY]Y{[n-1-n1]/n1n2} - 3(n-1-n1)2/(n-1-n1+n1n2)4}

= x0 - {(Mo/MH).Y{N2} - (N2)3/(N2+1)3}/{(Mo/MH).[lnY]Y{N2} - 3(N1)2/n1n2(N2+1)4}

.......

n = 1.N0 = Ni = 6.541188....⇒ Ni ∀i   for  ∏nk = n0 = 1

n = n1N1+1 = (234.472)(6.541188...)+1 = 1534.725.... for  ∏nk = n0n1 = n1

n = n1n2N2+1+n1 = (234.472x245.813)(6.541172)+1+234.472 = 377,244.12.... for  ∏nk = n0n1n2 = n1n2

n = n1n2n3N3+1+n1+n1n2 = (234.472x245.813x257.252)(6.541172)+1+234.472+(234.472x245.813) = 97,044,120.93.... for  ∏nk = n0n1n2n3= n1n2n3

......

Baryon-Dark Matter Intersection:

Nk=√2 for n = √2.Πnk + ΣΠnk-1

n0 = 1.√2 + 0 = no

n1 = n1√2 + 1 = 332.593 = n1√2 + 1

n2 = n1n2√2 + 1 + n1 = 81,745.461

n3 = n1n2n3√2 + 1 + n1 +n1n2 =  21,026,479.35

.....

 

friedmann8

 

 

 

Hypermass Evolution:

Yk{(n-ΣΠnk-1)/Πnk} = 2πΠnk.RHps = Πnk.RH/rps  = ΠnkMH*k/mH*k   for MH = c2RH/2Go and mH = c2rps/2Go

Hypermass MHyper = mH.Yk{(n-ΣΠnk-1)/Πnk}

 .....= Yn =  Y([n-1]/n1) = Y([n-1-n1]/n1n2) =.....

k=0 for MHyper = MH = 1.MH = mH.Y{(n)}        with  n = 1.{ln(2π/nps)/lnY} = n1

= 234.472

k=1 for MHyper = n1.MH = MH* =  mH.Y{(n-1)/n1}            with  n = [1] + n1.{ln(2πn1/nps)/lnY} = [1] + n1n2

= 1 + 234.472x245.812 = 57,637.03

k=2 for MHyper = n1n2.MH = MH** = mH.Y{(n-1-n1)/n1n2}       with  n = [1 + n1] + n1n2.{ln(2πn1n2/nps)/lnY} =  [1 + n1] + n1n2n3

= 235.472 + 234.472x245.812x257.251 = 14,827,185.4

k=3 for MHyper = n1n2n3.MH = MH*** = mH.Y{(n-1-n1-n1n2)/n1n2n3}    with  n = with  n = [1 + n1 + n1n2] + n1n2n3.{ln(2πn1n2n3/nps)/lnY} =  [1 + n1 + n1n2] + n1n2n3n4

= 57,871.74 + 234.472x245.812x257.251x268.785 = 3,985,817,947.8

 


The Friedmann's acceleration equation and its form for the Hubble time derivative from the Hubble expansion equation substitutes a curvature k=1 and a potential cosmological constant term; absorbing the curvature term and the cosmological constant term, which can however be set to zero if the resulting formulation incorporates a natural pressure term applicable to all times in the evolvement of the cosmology.


Deriving the Instanton of the 4D-dS Einstein cosmology for the Quantum Big Bang (QBB) from the initial-boundary conditions of the de Broglie matterwave hyper expansion of the Inflaton in 11D AdS then enables a cosmic evolution for those boundary parameters in cycle time n=Hot for a nodal 'Hubble Constant' Ho=dn/dt as a function for a time dependent expansion parameter H(n)=Ho/T(n)=Ho/T(Hot).

It is found, that the Dark Matter (DM) component of the universe evolves as a function of a density parameter for the coupling between the inflaton of AdS and the instanton of dS space times. It then is the coupling strength between the inflationary AdS brane epoch and the QBB dS boundary condition, which determines the time evolution of the Dark Energy (DE).
Parametrization of the expansion parameter H(n) then allows the cosmological constant term in the Friedmann equation to be merged with the scalar curvature term to effectively set an intrinsic density parameter at time instantenuity equal to Λ(n) for ΛpsQBB=GoMo/λps2 and where the wavelength of the de Broglie matter wave of the inflaton λps decouples as the Quantum Field Energy of the Planck Boson String in AdS and manifests as the measured mass density of the universe in the flatness of 4D Minkowski spacetime.



3. Temperature Evolution in the Multiverse

In the early radiation dominated cosmology; the quintessence was positive and the matter energy dominated the intrinsic Milgröm deceleration from the Instanton n=nps to n=0.18023 (about 3.04 Billion years) when the quintessence vanished and including a Recombination epoch when the hitherto opaque universe became transparent in the formation of the first hydrogen atoms from the quark-lepton plasma transmuted from the X-L Boson string class HO(32) of the Inflaton epoch preceding the Quantum Big Bang aka the Instanton.

From the modular membrane duality for wormhole radius rps = λps/2π, the critical modulated Schwarzschild radius rss = 2πλss = 2πx1022 m* for λps = 1/λss  and for an applied scalefactor a = n/[n+1] =λss/RH = {1-1/[n+1]}

for a n=Hot coordinate nrecombination = 6.259485x10-5 or about 6.259485x10-5(16.88 Gy) = 1.056601 Million years attenuated by exp{-hf/kT} = e-1 = 0.367879 to a characteristic cosmological time coordinate of 0.36788x1.056601 = 388,702 years after the Instanton nps.

The attenuation of the recombination coordinate then gives the cosmic temperature background for this epoch in the coordinate interval for the curvature radius R(n=2.302736x10-5) = 3.67894x1021 m* to R(n=6.259485x10-5) = 1022 m*.
This radial displacement scale represents the size of a typical major galaxy in the cosmology; a galactic structure, which became potentialised in the Schwarzschild matter evolution and its manifestation in the ylemic prototypical first generation magnetar-neutron stars, whose emergence was solely dependent on the experienced cosmic temperature background and not on their mass distributions.

The temperature evolution of the Instanton can be written as a function of the luminosity L(n,T) with R(n)=RH(n/[n+1]) as the radius of the luminating surface


L(nps,T(nps) = 6π2λps2.σ.Tnps4 = 2.6711043034x1096 Watts*, where σ = Stefan's Constant = 2π5k4/15h3c2 and as a product of the defined 'master constants' k, h, c2, π and 'e'.

L(n,T) = 3HoMo.c2/550n and for Temperature T(nps) ----------- T(nps) = 2.93515511x1036 Kelvin*.

T(n)4 = HoMoc2/(2π2σRH2[550n3/[n+1]2])  for  T(n)4 = {[n+1]2/n3}HoMoc2/(2π2σRH2[550]) = 18.1995{[n+1]2/n3} (K4/V)*

for a temperature interval in using the recombination epoch coordinates T(n1=6.2302736x10-5) = 2945.42 K* to T(n2=6.259485x10-5) = 2935.11 K*

This manifests as a 'false vacuum' and as a temperature gradient, as a causation of the Big Bang Instanton on physical grounds.
The metaphysical ground is the symmetry breaking from the source parity violation described in the birth and necessity of the Graviton to resymmetrize the UFoQR.

T(nps) of the singularity is 0.0389 or 3.89% of the pre-singularity.

So the POTENTIAL Temperature manifests as 3.89% in the KINETIC Temperature' which doubles in the Virial Theorem to 7.78% as 2KE + PE = 0:  TEMPERATURE/T(nps)=7.544808988..x1037/2.93515511x1036=25.705=1/0.03890...

[​IMG]


Applying the actual VPE at the Instanton to this temperature gradient:

ρVPEEMR = {4πEpsps3}/{8π5Eps4/15h3c3} = 15/2π4 = 0.07599486.. = 1/12.9878.. indicating the proportionality EVPE/EEMR = kTps/kTEMR = 2Tps/Tpotential at the Instanton from the Inflaton as a original form of the virial theorem, stating the Kinetic Energy of the Instanton and the QBB Lambda to be twice the Potential Energy of the de Broglie wave matter Inflaton, then manifesting as the Mo/2MHubble = rHyper/2RHubble Schwarzschild mass cosmo-evolution.

Now reducing the timeinstanton tps=nps/Ho of 3.33x10-31 seconds by the Temperature Gradient in the Luminosity Function gives you the scalar Higgs Potential Maximum at a pre-singularity time of tHiggsPE=tps.T(nps)/TEMPERATURE=1.297x10-32 seconds.

This then extrapolates the Big Bang singularity backwards in Time to harmonise the equations and to establish the 'driving force of the vacuum' as potential scalar Higgs Temperature Field.
All the further evolvement of the universe so becomes a function of Temperature and not of mass.
The next big phase transition is the attunement of the BOSONIC UNIFICATION, namely the 'singularity' temperature Tps=1.41x1020 K with the Luminosity function.
This occurs at a normal time of 1.9 nanoseconds into the cosmology.

It is then that the universe as a unity has this temperature and so allows BOSONIC differentiation between particles. The INDIVIDUATED PHOTON of the mass was born then and not before, as the entire universe was a PHOTON as a macroquantised superstring up to then.
The size of the universe at that time was that of being 1.14 metres across.
Next came the electroweak symmetry breaking at 1/365 seconds and at a temperature of so 1015 Kelvin* and so it continued.

The lower dimensional lightpath x=ct in lightspeed invariance c=lf so becomes modular dualised in the higher dimensional lightpath of the tachyonic de Broglie Inflaton-Instanton Vdebroglie=c/nps of the Inflaton.



{(2-n)(n+1)}3/n3 = VdS'/VdS ......(4.36038 for npresent) in the first completing Hubble cycle

n3/(2-n)3 =VAdS/VdS' ................. (2.22379 for npresent) in the first completing Hubble cycle

(n+1)3 = VAdS/VdS .....................(9.69657 for npresent) in the first completing Hubble cycle

ρcritical = 3Ho2/8πGo {Sphere} and Ho2/4π2Go {Hypersphere-Torus in factor 3π/2} (constant for all n per Hubble cycle)

ρcritical = 3.78782x10-27 [kg/m3]* and 8.038003x10-28 [kg/m3]*


ρdSVdS = ρdS'VdS' = ρAdSVAdS = ρcriticalVHubble = MHubble = c2RH/2Go = 6.47061227x1052 kg*


friedmann5.




3. The first Ylemic Stars in the Universe

The stability of stars is a function of the equilibrium condition, which balances the inward pull of gravity with the outward pressure of the thermodynamic energy or enthalpy of the star (H=PV+U). The Jeans Mass MJ and the Jeans Length RJ a used to describe the stability conditions for collapsing molecular hydrogen clouds to form stars say, are well known in the scientific data base, say in formulations such as:

MJ=3kTR/2Gm for a Jeans Length of: RJ=√{15kT/(4πρGm)}=RJ =√(kT/Gnm²).

Now the Ideal Gas Law of basic thermodynamics states that the internal pressure P and Volume of such an ideal gas are given by PV=nRT=NkT for n moles of substance being the Number N of molecules (say) divided by Avogadro's Constant L in n=N/L .

Since the Ideal Gas Constant R divided by Avogadro's Constant L and defines Boltzmann's Constant k=R/L. Now the statistical analysis of kinetic energy KE of particles in motion in a gas (say) gives a root-mean-square velocity (rms) and the familiar 2.KE=mv²(rms) from the distribution of individual velocities v in such a system.

It is found that PV=(2/3)N.KE as a total system described by the v(rms). Now set the KE equal to the Gravitational PE=GMm/R for a spherical gas cloud and you get the Jeans Mass. (3/2N).(NkT)=GMm/R with m the mass of a nucleon or Hydrogen atom and M=MJ=3kTR/2Gm as stated.

The Jeans' Length is the critical radius of a cloud (typically a cloud of interstellar dust) where thermal energy, which causes the cloud to expand, is counter acted by gravity, which causes the cloud to collapse. It is named after the British astronomer Sir James Jeans, who first derived the quantity; where k is Boltzmann Constant, T is the temperature of the cloud, r is the radius of the cloud, μ is the mass per particle in the cloud, G is the Gravitational Constant and ρ is the cloud's mass density (i.e. the cloud's mass divided by the cloud's volume).

Now following the Big Bang, there were of course no gas clouds in the early expanding universe and the Jeans formulations are not applicable to the mass seedling Mo; in the manner of the Jeans formulations as given.

However, the universe's dynamics is in the form of the expansion parameter of GR and so the R(n)=Rmax(n/(n+1)) scalefactor of Quantum Relativity.
So we can certainly analyse this expansion in the form of the Jeans Radius of the first proto-stars, which so obey the equilibrium conditions and equations of state of the much later gas clouds, for which the Jeans formulations then apply on a say molecular level.
This analysis so defines the ylemic neutron stars as 'Gamov proto-stars' and the first stars in the cosmogenesis and the universe.

Let the thermal internal energy or ITE=H be the outward pressure in equilibrium with the gravitational potential energy of GPE=Ω. The nuclear density in terms of the superbrane parameters is ρcritical=mc/Vcritical with mc a base-nuleon mass for a 'ylemic neutron'.

Vcritical= 4πRe3/3 or the volume for the ylemic neutron as given by the classical electron radius Re=1010λwormhole/360=e*/2c2.

H=(molarity)kT for molar volume as N=(R/Re)3 for dH=3kTR2/Re3.

Ω(R)= -∫GoMdm/R = -{3Gomc2/(Re3)2 }∫R4dR = -3Gomc2R5/Re6 for

dm/dR=d(ρV)/dR=4πρR2 and for ρ=3mc/4πRe3

For equilibrium, the requirement is that dH=dΩ in the minimum condition dH+dΩ=0.


This gives: dH+dΩ=3kTR2/Re3 - 16Goπ2ρ2R4/3=0 and the ylemic radius as:

Rylem=√{kTRe/Gomc2}

as the Jeans-Length precursor or progenitor for subsequent stellar and galactic generation.

The ylemic (Jeans) radii are all independent of the mass of the star as a function of its nuclear generated temperature. Applied to the proto-stars of the vortex neutron matter or ylem, the radii are all neutron star radii and define a specific range of radii for the gravitational collapse of the electron degenerate matter.

This spans from the 'First Three Minutes' scenario of the cosmogenesis to 1.1 million seconds (or about 13 days) and encompasses the standard beta decay of the neutron (underpinning radioactivity). The upper limit defines a trillion degree temperature and a radius of over 40 km; the trivial Schwarzschild solution gives a typical ylem radius of so 7.4 kilometers and the lower limit defines the 'mysterious' planetesimal limit as 1.8 km.

For long a cosmological conundrum, it could not be modelled just how the molecular and electromagnetic forces applicable to conglomerate matter distributions (say gaseous hydrogen as cosmic dust) on the quantum scale of molecules could become strong enough to form say 1 km mass concentrations, required for 'ordinary' gravity to assume control.

The ylem radii's lower limit is defined in this cosmology then show, that it is the ylemic temperature of the 1.2 billion degrees K, which perform the trick under the Ylem-Jeans formulation and which then is applied to the normal collapse of hydrogenic atoms in summation.

The stellar evolution from the ylemic (di-neutronic) templates is well established in QR and confirms most of the Standard Model's ideas of nucleosynthesis and the general Temperature cosmology. The standard model is correct in the temperature assignment, but is amiss in the corresponding 'size-scales' for the cosmic expansion.

The Big Bang cosmogenesis describes the universe as a Planck-Black Body Radiator, which sets the Cosmic-Microwave-Black Body Background Radiation Spectrum (CMBBR) as a function of n as T4=18.2(n+1)2/n3 and derived from the Stefan-Boltzmann-Law and the related statistical frequency distributions.

We have the GR metric for Schwarzschild-Black Hole Evolution as RS=2GM/c² as a function of the star's Black Hole's mass M and we have the ylemic Radius as a function of temperature only as Rylem√(kT.Re3/Gomc2).

The nucleonic mass-seed mc=mP.Alpha9 and the product Gomc2 is a constant in the partitioned n-evolution of

mc(n)=Yn.mc and G(n)=Go.Xn.

Identifying the ylemic Radius with the Schwarzschild Radius then indicates a specific mass a specific temperature and a specific radius.

Those we call the Chandrasekhar Parameters:

MChandra=1.5 solar Masses=3x1030 kg and RChandra=2GoMChandra/c² or 7407.40704..metres, which is the typical neutron star radius inferred today.

TChandra=RChandra2.Gomc2/kRe3 =1.985x1010 K for Electron Radius Re and Boltzmann's Constant k.

Those Chandrasekhar parameters then define a typical neutron star with a uniform temperature of 20 billion K at the white dwarf limit of ordinary stellar nucleosynthetic evolution (Hertzsprung-Russell or HR-diagram).
The Radius for the massparametric Universe is given in R(n)=Rmax(1-n/(n+1)) correlating the ylemic temperatures as the 'uniform' CMBBR-background and we can follow the evolution of the ylemic radius via the approximation:

Rylem=0.05258..√T=(0.0753).[(n+1)2/n3][1/8]

Rylem(npresent=1.132711..)=0.0868.. m* for a Tylem(npresent )=2.728 K for the present time  tpresent=npresent/Ho.

What then is nChandra?

This would describe the size of the universe as the uniform temperature CMBBR today manifesting as the largest stars, mapped however onto the ylemic neutron star evolution as the protostars (say as nChandra'), defined not in manifested mass (say neutron conglomerations), but as a quark-strange plasma, (defined in QR as the Vortex-Potential-Energy or VPE).

R(nChandra')=Rmax(nChandra'/(nChandra'+1))=7407.40741.. for nChandra'=4.64x10-23 and so a time of tChandra'=nChandra'/Ho=nChandra'/1.88x10-18=2.47x10-5 seconds.

QR defines the Weyl-Temperature limit for Bosonic Unification as 1.9 nanoseconds at a temperature of 1.4x1020 Kelvin and the weak-electromagnetic unification at 1/365 seconds at T=3.4x1015 K.

So we place the first ylemic proto-star after the bosonic unification (before which the plenum was defined as undifferentiated 'bosonic plasma'), but before the electro-weak unification, which defined the Higgs-Bosonic restmass induction via the weak interaction vector-bosons and allowing the di-neutrons to be born.

The universe was so 15 km across, when its ylemic 'concentrated' VPE-Temperature was so 20 Billion K and we find the CMBBR in the Stefan-Boltzmann-Law as:  T4=18.20(n+1)2/n3=1.16x1017 Kelvin.

So the thermodynamic temperature for the expanding universe was so 5.85 Million times greater than the ylemic VPE-Temperature; and implying that no individual ylem stars could yet form from the mass seedling Mo.

The universe's expansion however cooled the CMBBR background and we to calculate the scale of the universe corresponding to this ylemic scenario; we simply calculate the 'size' for the universe at TChandra=20 Billion K for TChandra4 and we then find

nChandra=4.89x10-14 and tChandra=26,065 seconds or so 7.24 hours.

The Radius R(nChandra)=7.81x1012 metres or 7.24 lighthours.  This is about 52 Astronomical Units and an indicator for the largest possible star in terms of radial extent and the 'size' of a typical solar system, encompassed by supergiants on the HR-diagram.

We so know that the ylemic temperature decreases in direct proportion to the square of the ylemic radius and one hitherto enigmatic aspect in cosmology relates to this in the planetesimal limit. Briefly, a temperature of so 1.2 billion degrees defines an ylemic radius of 1.8 km as the dineutronic limit for proto-neutron stars contracting from so 80 km down to this size just 1.1 million seconds or so 13 days after the Big Bang.

This then 'explains' why chunks of matter can conglomerate via molecular and other adhesive interactions towards this size, where then the accepted gravity is strong enough to build planets and moons. It works, because the ylemic template is defined in subatomic parameters reflecting the mesonic-inner and leptonic outer ring boundaries, the planetesimal limit being the leptonic mapping. So neutrino- and quark blueprints micro-macro dance their basic definition as the holographic projections of the space-time quanta.

Now because the Electron Radius is directly proportional to the linearised wormhole perimeter and then the Compton Radius via Alpha in Re=1010λwormhole/360=e*/2c2=Alpha.RCompton, the Chandrasekhar White Dwarf limit should be doubled to reflect the protonic diameter mirrored in the classical electron radius.

Hence any star experiencing electron degeneracy is actually becoming ylemic or dineutronic, the boundary for this process being the Chandrasekhar mass. This represents the subatomic mapping of the first Bohr orbit collapsing onto the leptonic outer ring in the quarkian wave-geometry.
But this represents the Electron Radius as a Protonic Diameter and the Protonic Radius must then indicate the limit for the scale where proton degeneracy would have to enter the scenario. As the proton cannot degenerate in that way, the neutron star must enter Black Hole phase transition at the Re/2 scale, corresponding to a mass of 8MChandra=24x1030 kg* or 12 solar masses.

The maximum ylemic radius so is found from the constant density proportion ρ=M/V:  (Rylemmax/Re)3=MChandra/mc for Rylemmax=40.1635 km.

The corresponding ylemic temperature is 583.5 Billion K for a CMBBR-time of 287 seconds or so 4.8 minutes from a n=5.4x10-16, when the universe had a diameter of so 173 Million km.
But for a maximum nuclear compressibility for the protonic radius, we find:

(Rylemmax/Re)3=8MChandra/mc for Rylemmax=80.327 km, a ylemic temperature of 2,334 Billion K for a n-cycletime of 8.5x10-17 and a CMBBR-time of so 45 seconds and when the universe had a radius of 13.6 Million km or was so 27 Million km across.

The first ylemic protostar vortex was at that time manifested as the ancestor for all neutron star generations to follow. This vortex is described in a cosmic string encircling a spherical region so 160 km across and within a greater universe of diameter 27 Million km which carried a thermodynamic temperature of so 2.33 Trillion Kelvin at that point in the cosmogenesis.

This vortex manifested as a VPE concentration after the expanding universe had cooled to allow the universe to become transparent from its hitherto defining state of opaqueness and a time known as the decoupling of matter (in the form of the Mo seedling partitioned in mc's) from the radiation pressure of the CMBBR photons.

The temperature for the decoupling is found in the galactic scale-limit modular dual to the wormhole geodesic as 1/λwormholeantiwormholegalaxyserpent=1022 metres or so 1.06 Million ly and its luminosity attenuation in the 1/e proportionality for then 388,879 lightyears as a decoupling time ndecoupling.

A maximum galactic halo limit is modulated in 2πλantiwormhole metres in the linearisation of the Planck-length encountered before in an earlier discussion.

R(ndecoupling)=Rmax(ndecoupling/(ndecouplingc+1))=1022 metres for ndecoupling=6.26x10-5 and so for a CMBBR-Temperature of about T=2935 K for a galactic protocore then attenuated in so 37% for ndecouplingmin=1.0x10-6 for R=λantiwormhole/2π and

ndecouplingmax=3.9x10-4 for R=2πλantiwormhole and for temperatures of so 65,316 K and 744 K respectively, descriptive of the temperature modulations between the galactic cores and the galactic halos.

So a CMBBR-temperature of so 65,316 K at a time of so 532 Billion seconds or 17,000 years defined the initialisation of the VPE and the birth of the first ylemic protostars as a decoupling minimum. The ylemic mass currents were purely monopolic and known as superconductive cosmic strings, consisting of nucleonic neutrons, each of mass mc.

If we assign this timeframe to the maximised ylemic radius and assign our planetesimal limit of fusion temperature 1.2 Billion K as a corresponding minimum; then this planetesimal limit representing the onset of stellar fusion in a characteristic temperature, should indicate the first protostars at a temperature of the CMBBR of about 744 Kelvin.

The universe had a tremperature of 744 K for ndecouplingmax=3.9x10-4 for R=2πλantiwormhole and this brings us to a curvature radius of so 6.6 Million lightyears and an 'ignition-time' for the first physical ylemic neutron stars as first generation protostars of so 7 Million years after the Big Bang.

The important cosmological consideration is that of distance-scale modulation.
The Black Hole Schwarzschild metric is the inverse of the galactic scale metric.
The linearisation of the Planck-String as the Weyl-Geodesic and so the wormhole radius in the curvature radius R(n) is modular dual and mirrored in inversion in the manifestation of galactic structure with a nonluminous halo a luminous attenuated diameter-bulge and a superluminous (quasar or White Hole Core).

The core-bulge ratio on the scale of 0.002 to 0.001 will so reflect the eigen energy quantum of the wormhole as a heterotic Planck-Boson-Weyl-String or as the magnetocharge as 1/500, being the mapping of the Stoney-Planck-Length-Bounce as

e=lP.c²√Alpha onto the electron radius in e*=2Re.c²=1/Epsps/hc in the modular string-T-duality applied to the self-dual monopole as string class IIB.






4. A Synthesis of LCDM with MOND in an Universal Lambda Milgröm Deceleration

[​IMG]

[Excerpt from Wikipedia:
https://en.wikipedia.org/wiki/Modified_Newtonian_dynamics

Several independent observations point to the fact that the visible mass in galaxies and galaxy clusters is insufficient to account for their dynamics, when analysed using Newton's laws. This discrepancy – known as the "missing mass problem" – was first identified for clusters by Swiss astronomer Fritz Zwicky in 1933 (who studied the Coma cluster),[4][5] and subsequently extended to include spiral galaxies by the 1939 work of Horace Babcock on Andromeda.[6] These early studies were augmented and brought to the attention of the astronomical community in the 1960s and 1970s by the work of Vera Rubin at the Carnegie Institute in Washington, who mapped in detail the rotation velocities of stars in a large sample of spirals. While Newton's Laws predict that stellar rotation velocities should decrease with distance from the galactic centre, Rubin and collaborators found instead that they remain almost constant[7] – the rotation curves are said to be "flat". This observation necessitates at least one of the following: 1) There exists in galaxies large quantities of unseen matter which boosts the stars' velocities beyond what would be expected on the basis of the visible mass alone, or 2) Newton's Laws do not apply to galaxies. The former leads to the dark matter hypothesis; the latter leads to MOND.

[​IMG]
MOND was proposed by Mordehai Milgrom in 1983

The basic premise of MOND is that while Newton's laws have been extensively tested in high-acceleration environments (in the Solar System and on Earth), they have not been verified for objects with extremely low acceleration, such as stars in the outer parts of galaxies. This led Milgrom to postulate a new effective gravitational force law (sometimes referred to as "Milgrom's law") that relates the true acceleration of an object to the acceleration that would be predicted for it on the basis of Newtonian mechanics.[1] This law, the keystone of MOND, is chosen to reduce to the Newtonian result at high acceleration but lead to different ("deep-MOND") behaviour at low acceleration:

[​IMG] ........(1)

Here FN is the Newtonian force, m is the object's (gravitational) mass, a is its acceleration, μ(x) is an as-yet unspecified function (known as the "interpolating function"), and a0 is a new fundamental constant which marks the transition between the Newtonian and deep-MOND regimes. Agreement with Newtonian mechanics requires μ(x) → 1 for x >> 1, and consistency with astronomical observations requires μ(x) → x for x << 1. Beyond these limits, the interpolating function is not specified by the theory, although it is possible to weakly constrain it empirically.[8][9] Two common choices are:

[​IMG] ("Simple interpolating function"),
and
[​IMG] ("Standard interpolating function").

Thus, in the deep-MOND regime (a << a0):

[​IMG]

Applying this to an object of mass m in circular orbit around a point mass M (a crude approximation for a star in the outer regions of a galaxy), we find:

[​IMG] .......(2)

that is, the star's rotation velocity is independent of its distance r from the centre of the galaxy – the rotation curve is flat, as required. By fitting his law to rotation curve data, Milgrom found a0 ≈ 1.2 x 10−10 m s−2 to be optimal. This simple law is sufficient to make predictions for a broad range of galactic phenomena.
Milgrom's law can be interpreted in two different ways. One possibility is to treat it as a modification to the classical law of inertia (Newton's second law), so that the force on an object is not proportional to the particle's acceleration a but rather to μ(a/a0)a. In this case, the modified dynamics would apply not only to gravitational phenomena, but also those generated by other forces, for example electromagnetism.[10] Alternatively, Milgrom's law can be viewed as leaving Newton's Second Law intact and instead modifying the inverse-square law of gravity, so that the true gravitational force on an object of mass m due to another of mass M is roughly of the form GMm/(μ(a/a0)r2). In this interpretation, Milgrom's modification would apply exclusively to gravitational phenomena.
[End of excerpt]




For LCDM:
acceleration a: a = G{MBM+mDM}/R2

For MOND:

acceleration a: a+amil = a{a/ao} = GMBM/R2 = v4/ao.R2 for v4 = GMBMao

amil = a{a/ao-1} = a{a-ao}/ao = GMBM/R2 - a

For Newtonian acceleration a: G{MBM+mDM}/R2 = a = GMBM/R2 - amil

amil = - GmDM/R2 = (a/ao)(a-ao) and relating the Dark Matter to the Milgröm constant in interpolation amil

for the Milgröm deceleration applied to the Dark Matter and incorporating the radial independence of rotation velocities in the galactic structures as an additional acceleration term in the Newtonian gravitation as a function for the total mass of the galaxy and without DM in MOND.

Both, LCDM and MOND consider the Gravitational 'Constant' constant for all accelerations and vary either the mass content in LCDM or the acceleration in MOND in the Newtonian Gravitation formulation respectively.
The standard gravitational parameter GM in a varying mass term G(M+m) = M(G+ΔG) reduces to Gm=ΔGM for a varying Gravitational parameter G in (G+ΔG) = f(G).

The Dark Matter term GmDM can be written as GmDM/R2 = -amil = a - a2/ao = ΔGM/R2 to identify the Milgröm acceleration constant as an intrinsic and universal deceleration related to the Dark Energy and the negative pressure term of the cosmological constant invoked to accommodate the apparent acceleration of the universal expansion (qdS = -0.55858).

ΔG = Go-G(n) in amil = -2cHo/[n+1]3 = {Go-G(n)}M/R2 for some function G(n) descriptive for the change in f(G).

The Milgröm constant so is not constant, but emerges as the initial boundary condition in the Instanton aka the Quantum Big Bang and is identfied as the parametric deceleration parameter in Friedmann's solutions to Einstein's Field Equations in

amil.ao = a(a-ao) and ao(amil + a) = a2 or ao = a2/(amil+a).

A(n)= -2cHo/[n+1]3 = -2cHo2/RH[n+1]3 and calculates as -1.112663583x10-9 (m/s2)* at the Instanton and as -1.1614163x10-10 (m/s2)* for the present time coordinate.

The Gravitational Constant G(n)=GoXn in the standard gravitational parameter represents a fine structure in conjunction with a sub scale quantum mass evolution for a proto nucleon mass

mc = alpha9.mPlanck from the gravitational interaction fine structure constant ag = 2πGomc2/hc = 3.438304..x10-39 = alpha18 to unify electromagnetic and gravitational quantum interactions.

The proto nucleon mass mc(n) so varies as complementary fine structure to the finestructure for G in mcYn for a truly constant Go as defined in the interaction unification

.
G(n)M(n)=GoXn.MoYn = GoMo(XY)n = GoMo in the macro evolution of baryonic mass seedling Mo and Gomc in the micro evolution of the nucleonic seed remain constant to describes a particular fine structure for the time frame in the cosmogenesis when the non-luminous Dark Matter remains separate from the luminous Baryon mass.

The DM-BM intersection coordinate is calculated for a cycletime n=Hot=1.4142..or at an universal true electromagnetic age of 23.872 billion years

At that time, the {BM-DM-DE} mass density distribution will be {5.536%; 22.005%; 72.459%}, with the G(n)M(n) assuming a constant value in the Hubble cycle.

The Dark Energy pressure will be PPBM∩DM = -3.9300x10-11 (N/m2)* with a corresponding 'quasi cosmological constant' of LBM∩DM = -6.0969x10-37 (s-2)*.

Within a local inertial frame of measurement; the gravitational constant so becomes a function of the micro evolution of the proto nucleon mass mc from the string epoch preceding the Instanton.
A localized measurement of G so engages the value of the mass of a neutron as evolved mc in a coupling to the evolution of the macro mass seedling Mo and so the baryonic omega

Ωo=Mo/MH = 0.02803115 in the critical density ρcritical = 3Ho2/8πGo = 3MH/4πRH3 = 3c2/8πGoRH2 for the zero curvature and a Minkowski flat cosmology.

The fine structure for G so engages both the micro mass mc and the macro mass Mo, the latter being described in the overall Hypermass evolution of the universe as a Black Hole cosmology in a 5/11D AdS 'closed' spacetime encompassing the dS spacetime evolution of the 4/10D 'open' universe.
Details are described in a later section of this discourse.

The Milgröm 'constant' so relates an intrinsic Dark Energy cosmology to the macro cosmic hypermass evolution of Black Holes at the cores of galaxies and becomes universally applicable in that context.
No modification of Newtonian gravitation is necessary, if the value of a locally derived and measured G is allowed to increase to its string based (Planck-Stoney) value of Go=1/k=4πεo = 1.111..x10-10 string unification units [C*=m3/s2] and relating spacial volume to angular acceleration in gravitational parameter GM.

The necessity for Dark Matter to harmonise the hypermass evolution remains however, with the Dark Energy itself assuming the form of the Milgröm deceleration.


amil = -2cHo/[n+1]3 = -{Go-G(n)}M/R2 = -Go{1-Xn}M/R2 for the gravitational parameter GM coupled to the size of a galactic structure harbouring a central Black Hole-White Hole/Quasar power source.

GoM/R2 = 2cHo/{(1-Xn)(n+1)3}


For a present n=1.132711 ......{(1-Xn)(n+1)}3 = 4.07617837...,then for M/R2 = constant = 2.4875586...

For the Milky Way barred spiral galaxy and a total BM+DM mass of 1.7x1042 kg, the mass distribution would infer a diameter of 8.2668x1020 m or 87,321.56 light years, inclusive the Dark Matter halo extension.

For the Andromeda barred spiral galaxy and a total BM+DM mass of 3x1042 kg, the galaxy's diameter would increase to 1.0982x1021 m or 116,000 light years for a total matter distribution.